C22H26N4O2 — CID 108976886
1-N'-(4-piperidin-1-ylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976886) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-N'-(4-piperidin-1-ylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-piperidin-1-ylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976886 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-N'-(4-piperidin-1-ylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)C1(C(=O)Nc2ccc(N3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H26N4O2/c27-20(24-16-17-5-4-12-23-15-17)22(10-11-22)21(28)25-18-6-8-19(9-7-18)26-13-2-1-3-14-26/h4-9,12,15H,1-3,10-11,13-14,16H2,(H,24,27)(H,25,28) |
| InChIKey | FLIPFGDTDWDCSE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|