C22H24N6O — CID 109307275
N-(4-piperidin-1-ylphenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109307275) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is N-(4-piperidin-1-ylphenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-piperidin-1-ylphenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109307275 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-(4-piperidin-1-ylphenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)c1ccnc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C22H24N6O/c29-21(26-18-6-8-19(9-7-18)28-13-2-1-3-14-28)20-10-12-24-22(27-20)25-16-17-5-4-11-23-15-17/h4-12,15H,1-3,13-14,16H2,(H,26,29)(H,24,25,27) |
| InChIKey | RRGAASKDUFEVBE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|