C17H14FN5O — CID 109307236
N-(4-fluorophenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109307236) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109307236 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-(4-fluorophenyl)-2-(pyridin-3-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccnc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C17H14FN5O/c18-13-3-5-14(6-4-13)22-16(24)15-7-9-20-17(23-15)21-11-12-2-1-8-19-10-12/h1-10H,11H2,(H,22,24)(H,20,21,23) |
| InChIKey | LUXDVCQQULVPQA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |