C19H16F2N4O — CID 109308419
N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109308419) has the molecular formula C19H16F2N4O and a molecular weight of 354.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109308419 |
| Molecular Formula | C19H16F2N4O |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccnc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H16F2N4O/c20-14-3-1-13(2-4-14)9-11-22-19-23-12-10-17(25-19)18(26)24-16-7-5-15(21)6-8-16/h1-8,10,12H,9,11H2,(H,24,26)(H,22,23,25) |
| InChIKey | PVGATRGBVHVOMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |