C21H20ClFN4O — CID 109308380
N-[2-(4-chlorophenyl)ethyl]-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide (PubChem CID 109308380) has the molecular formula C21H20ClFN4O and a molecular weight of 398.87 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109308380 |
| Molecular Formula | C21H20ClFN4O |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2-[2-(4-fluorophenyl)ethylamino]pyrimidine-4-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccnc(NCCc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H20ClFN4O/c22-17-5-1-15(2-6-17)9-12-24-20(28)19-11-14-26-21(27-19)25-13-10-16-3-7-18(23)8-4-16/h1-8,11,14H,9-10,12-13H2,(H,24,28)(H,25,26,27) |
| InChIKey | VUHDZNIOVNSZTA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |