C18H17ClN4O2 — CID 109303449
2-[2-(4-chlorophenyl)ethylamino]-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 109303449) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethylamino]-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[2-(4-chlorophenyl)ethylamino]-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109303449 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethylamino]-N-(furan-2-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1ccnc(NCCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C18H17ClN4O2/c19-14-5-3-13(4-6-14)7-9-20-18-21-10-8-16(23-18)17(24)22-12-15-2-1-11-25-15/h1-6,8,10-11H,7,9,12H2,(H,22,24)(H,20,21,23) |
| InChIKey | DAUOVZSJXQUSMC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |