C18H18N4O2 — CID 109303420
N-(furan-2-ylmethyl)-2-[(4-methylphenyl)methylamino]pyrimidine-4-carboxamide (PubChem CID 109303420) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(4-methylphenyl)methylamino]pyrimidine-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(4-methylphenyl)methylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109303420 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(4-methylphenyl)methylamino]pyrimidine-4-carboxamide |
| SMILES | Cc1ccc(CNc2nccc(C(=O)NCc3ccco3)n2)cc1 |
| InChI | InChI=1S/C18H18N4O2/c1-13-4-6-14(7-5-13)11-21-18-19-9-8-16(22-18)17(23)20-12-15-3-2-10-24-15/h2-10H,11-12H2,1H3,(H,20,23)(H,19,21,22) |
| InChIKey | PTWFXBFIQVRDJY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |