C17H18N4O2 — CID 108976772
1-N,1-N'-bis(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976772) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 1-N,1-N'-bis(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N,1-N'-bis(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976772 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-N,1-N'-bis(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)C1(C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C17H18N4O2/c22-15(20-11-13-3-1-7-18-9-13)17(5-6-17)16(23)21-12-14-4-2-8-19-10-14/h1-4,7-10H,5-6,11-12H2,(H,20,22)(H,21,23) |
| InChIKey | SLUOUOYCKGZIOC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|