C19H21N3O3 — CID 108976865
1-N'-(2-methoxy-5-methylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108976865) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 1-N'-(2-methoxy-5-methylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(2-methoxy-5-methylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108976865 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-N'-(2-methoxy-5-methylphenyl)-1-N-(pyridin-3-ylmethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)C1(C(=O)NCc2cccnc2)CC1 |
| InChI | InChI=1S/C19H21N3O3/c1-13-5-6-16(25-2)15(10-13)22-18(24)19(7-8-19)17(23)21-12-14-4-3-9-20-11-14/h3-6,9-11H,7-8,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | LAFUSDCPCCIIRS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|