C7H7N2O2- — CID 19082872
N-(pyridin-3-ylmethyl)carbamate (PubChem CID 19082872) has the molecular formula C7H7N2O2- and a molecular weight of 151.14 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 19082872 |
| Molecular Formula | C7H7N2O2- |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | N-(pyridin-3-ylmethyl)carbamate |
| SMILES | O=C([O-])NCc1cccnc1 |
| InChI | InChI=1S/C7H8N2O2/c10-7(11)9-5-6-2-1-3-8-4-6/h1-4,9H,5H2,(H,10,11)/p-1 |
| InChIKey | QCIPSBWBQQHNFS-UHFFFAOYSA-M |
| XLogP | -0.49 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |