C20H14F4N4O2 — CID 1204787
2,3,5,6-tetrafluoro-1-N,4-N-bis(pyridin-3-ylmethyl)benzene-1,4-dicarboxamide (PubChem CID 1204787) has the molecular formula C20H14F4N4O2 and a molecular weight of 418.35 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-1-N,4-N-bis(pyridin-3-ylmethyl)benzene-1,4-dicarboxamide.
| Compound Name | 2,3,5,6-tetrafluoro-1-N,4-N-bis(pyridin-3-ylmethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 1204787 |
| Molecular Formula | C20H14F4N4O2 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2,3,5,6-tetrafluoro-1-N,4-N-bis(pyridin-3-ylmethyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(NCc1cccnc1)c1c(F)c(F)c(C(=O)NCc2cccnc2)c(F)c1F |
| InChI | InChI=1S/C20H14F4N4O2/c21-15-13(19(29)27-9-11-3-1-5-25-7-11)16(22)18(24)14(17(15)23)20(30)28-10-12-4-2-6-26-8-12/h1-8H,9-10H2,(H,27,29)(H,28,30) |
| InChIKey | AREDGTFFWPTXGK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|