C22H10F10N2O2 — CID 4597287
2,3,4,5,6-pentafluoro-N-[[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]methyl]benzamide (PubChem CID 4597287) has the molecular formula C22H10F10N2O2 and a molecular weight of 524.31 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 4597287 |
| Molecular Formula | C22H10F10N2O2 |
| Molecular Weight | 524.31 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-[[(2,3,4,5,6-pentafluorobenzoyl)amino]methyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(CNC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H10F10N2O2/c23-11-9(12(24)16(28)19(31)15(11)27)21(35)33-5-7-1-2-8(4-3-7)6-34-22(36)10-13(25)17(29)20(32)18(30)14(10)26/h1-4H,5-6H2,(H,33,35)(H,34,36) |
| InChIKey | BOYVMBDTVZRWRS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.31 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|