C20H22F2N2O — CID 51232553
2,6-difluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 51232553) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 51232553 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2,6-difluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(CN2CCCCC2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H22F2N2O/c21-17-5-4-6-18(22)19(17)20(25)23-13-15-7-9-16(10-8-15)14-24-11-2-1-3-12-24/h4-10H,1-3,11-14H2,(H,23,25) |
| InChIKey | TUYMMCDOYOLEQV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |