C20H22BrFN2O — CID 8545995
5-bromo-2-fluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 8545995) has the molecular formula C20H22BrFN2O and a molecular weight of 405.31 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 5-bromo-2-fluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 8545995 |
| Molecular Formula | C20H22BrFN2O |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 5-bromo-2-fluoro-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(CN2CCCCC2)cc1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C20H22BrFN2O/c21-17-8-9-19(22)18(12-17)20(25)23-13-15-4-6-16(7-5-15)14-24-10-2-1-3-11-24/h4-9,12H,1-3,10-11,13-14H2,(H,23,25) |
| InChIKey | WIRGUEXFDSEQTN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |