C24H20F4N2O2 — CID 1109048
2,4,5,6-tetrafluoro-1-N,3-N-bis(2-phenylethyl)benzene-1,3-dicarboxamide (PubChem CID 1109048) has the molecular formula C24H20F4N2O2 and a molecular weight of 444.43 g/mol. Its IUPAC name is 2,4,5,6-tetrafluoro-1-N,3-N-bis(2-phenylethyl)benzene-1,3-dicarboxamide.
| Compound Name | 2,4,5,6-tetrafluoro-1-N,3-N-bis(2-phenylethyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 1109048 |
| Molecular Formula | C24H20F4N2O2 |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2,4,5,6-tetrafluoro-1-N,3-N-bis(2-phenylethyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(NCCc1ccccc1)c1c(F)c(F)c(F)c(C(=O)NCCc2ccccc2)c1F |
| InChI | InChI=1S/C24H20F4N2O2/c25-19-17(23(31)29-13-11-15-7-3-1-4-8-15)20(26)22(28)21(27)18(19)24(32)30-14-12-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,29,31)(H,30,32) |
| InChIKey | INUKOLCPZBLUMX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|