C18H12F5NO2 — CID 164996905
2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzamide (PubChem CID 164996905) has the molecular formula C18H12F5NO2 and a molecular weight of 369.29 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 164996905 |
| Molecular Formula | C18H12F5NO2 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzamide |
| SMILES | CC(=O)/C=C/c1ccc(CNC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H12F5NO2/c1-9(25)2-3-10-4-6-11(7-5-10)8-24-18(26)12-13(19)15(21)17(23)16(22)14(12)20/h2-7H,8H2,1H3,(H,24,26)/b3-2+ |
| InChIKey | ZDLCXOZVJLDAOD-NSCUHMNNSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|