C20H19NO4 — CID 163207808
methyl (E)-3-[4-[[(4-acetylbenzoyl)amino]methyl]phenyl]prop-2-enoate (PubChem CID 163207808) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl (E)-3-[4-[[(4-acetylbenzoyl)amino]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[(4-acetylbenzoyl)amino]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 163207808 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl (E)-3-[4-[[(4-acetylbenzoyl)amino]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(CNC(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-14(22)17-8-10-18(11-9-17)20(24)21-13-16-5-3-15(4-6-16)7-12-19(23)25-2/h3-12H,13H2,1-2H3,(H,21,24)/b12-7+ |
| InChIKey | WBPFSZKRVPRGDT-KPKJPENVSA-N |
| XLogP | 3.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|