C18H17NO4 — CID 163207822
methyl 4-[[(4-acetylbenzoyl)amino]methyl]benzoate (PubChem CID 163207822) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is methyl 4-[[(4-acetylbenzoyl)amino]methyl]benzoate.
| Compound Name | methyl 4-[[(4-acetylbenzoyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 163207822 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 4-[[(4-acetylbenzoyl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C18H17NO4/c1-12(20)14-7-9-15(10-8-14)17(21)19-11-13-3-5-16(6-4-13)18(22)23-2/h3-10H,11H2,1-2H3,(H,19,21) |
| InChIKey | AYMDLBOOPCAYML-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |