C21H18F3NO4 — CID 9457612
[2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 9457612) has the molecular formula C21H18F3NO4 and a molecular weight of 405.37 g/mol. Its IUPAC name is [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 9457612 |
| Molecular Formula | C21H18F3NO4 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [2-[4-(acetamidomethyl)phenyl]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CC(=O)NCc1ccc(C(=O)COC(=O)/C=C/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H18F3NO4/c1-14(26)25-12-16-2-7-17(8-3-16)19(27)13-29-20(28)11-6-15-4-9-18(10-5-15)21(22,23)24/h2-11H,12-13H2,1H3,(H,25,26)/b11-6+ |
| InChIKey | BHFYHLLEZNPQLS-IZZDOVSWSA-N |
| XLogP | 3.78 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|