C17H19F3N2O4 — CID 8935200
[2-(butylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 8935200) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8935200 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N2O4/c1-2-3-10-21-16(25)22-14(23)11-26-15(24)9-6-12-4-7-13(8-5-12)17(18,19)20/h4-9H,2-3,10-11H2,1H3,(H2,21,22,23,25)/b9-6+ |
| InChIKey | VVZOZQAWYAMEGL-RMKNXTFCSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|