C21H20F3NO3 — CID 7355478
[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7355478) has the molecular formula C21H20F3NO3 and a molecular weight of 391.39 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7355478 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@H](CNC(=O)COC(=O)/C=C/c1ccc(C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H20F3NO3/c1-15(17-5-3-2-4-6-17)13-25-19(26)14-28-20(27)12-9-16-7-10-18(11-8-16)21(22,23)24/h2-12,15H,13-14H2,1H3,(H,25,26)/b12-9+/t15-/m1/s1 |
| InChIKey | VFSXJGMMJUFTDJ-SAAWKEMMSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|