C18H14F3NO3 — CID 71953472
[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-phenylprop-2-enoate (PubChem CID 71953472) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-phenylprop-2-enoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 71953472 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethyl)anilino]ethyl] 3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccccc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3NO3/c19-18(20,21)14-7-9-15(10-8-14)22-16(23)12-25-17(24)11-6-13-4-2-1-3-5-13/h1-11H,12H2,(H,22,23) |
| InChIKey | XDQOFRVTMMWSPH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|