C26H16F3NO5 — CID 41223777
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 41223777) has the molecular formula C26H16F3NO5 and a molecular weight of 479.41 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 41223777 |
| Molecular Formula | C26H16F3NO5 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(C(F)(F)F)cc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H16F3NO5/c27-26(28,29)16-11-8-15(9-12-16)10-13-22(32)35-14-21(31)30-20-7-3-6-19-23(20)25(34)18-5-2-1-4-17(18)24(19)33/h1-13H,14H2,(H,30,31)/b13-10+ |
| InChIKey | IQSPZCREOYNYAV-JLHYYAGUSA-N |
| XLogP | 4.68 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|