C22H14N2O5 — CID 3592243
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 3592243) has the molecular formula C22H14N2O5 and a molecular weight of 386.36 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] pyridine-4-carboxylate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 3592243 |
| Molecular Formula | C22H14N2O5 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccncc1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H14N2O5/c25-18(12-29-22(28)13-8-10-23-11-9-13)24-17-7-3-6-16-19(17)21(27)15-5-2-1-4-14(15)20(16)26/h1-11H,12H2,(H,24,25) |
| InChIKey | AWJPAFBIIOJIKW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|