methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate

C23H15NO5 — CID 4138390

IUPACmethyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1
InChIInChI=1S/C23H15NO5/c1-29-23(28)14-11-9-13(10-12-14)22(27)24-18-8-4-7-17-19(18)21(26)16-6-3-2-5-15(16)20(17)25/h2-12H,1H3,(H,24,27)
InChIKeyMZTOFXHVNVHJNX-UHFFFAOYSA-N
MW385.38 g/mol
LogP3.50
Rot. Bonds3

About methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate

methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate (PubChem CID 4138390) has the molecular formula C23H15NO5 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate
PubChem CID4138390
Molecular FormulaC23H15NO5
Molecular Weight385.38 g/mol
Exact Mass385.10
IUPAC Namemethyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate
SMILESCOC(=O)c1ccc(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1
InChIInChI=1S/C23H15NO5/c1-29-23(28)14-11-9-13(10-12-14)22(27)24-18-8-4-7-17-19(18)21(26)16-6-3-2-5-15(16)20(17)25/h2-12H,1H3,(H,24,27)
InChIKeyMZTOFXHVNVHJNX-UHFFFAOYSA-N
XLogP3.50
TPSA89.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.38
LogP ≤ 53.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}

Analyze methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate?
The IUPAC name of methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate (CID 4138390) is methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate.
What is the SMILES notation for methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate?
The canonical SMILES for methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate is COC(=O)c1ccc(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1.
What is the InChIKey of methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate?
The InChIKey is MZTOFXHVNVHJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15NO5/c1-29-23(28)14-11-9-13(10-12-14)22(27)24-18-8-4-7-17-19(18)21(26)16-6-3-2-5-15(16)20(17)25/h2-12H,1H3,(H,24,27).
What are the key properties of methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate?
methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate has a molecular weight of 385.38 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate is sourced from PubChem (CID 4138390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).