C23H15NO5 — CID 4138390
methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate (PubChem CID 4138390) has the molecular formula C23H15NO5 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate.
| Compound Name | methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 4138390 |
| Molecular Formula | C23H15NO5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | methyl 4-[(9,10-dioxoanthracen-1-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H15NO5/c1-29-23(28)14-11-9-13(10-12-14)22(27)24-18-8-4-7-17-19(18)21(26)16-6-3-2-5-15(16)20(17)25/h2-12H,1H3,(H,24,27) |
| InChIKey | MZTOFXHVNVHJNX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|