C38H34N2O8 — CID 6144251
butyl 4-[[4-[(4-butoxycarbonylbenzoyl)amino]-9,10-dioxoanthracen-1-yl]carbamoyl]benzoate (PubChem CID 6144251) has the molecular formula C38H34N2O8 and a molecular weight of 646.70 g/mol. Its IUPAC name is butyl 4-[[4-[(4-butoxycarbonylbenzoyl)amino]-9,10-dioxoanthracen-1-yl]carbamoyl]benzoate.
| Compound Name | butyl 4-[[4-[(4-butoxycarbonylbenzoyl)amino]-9,10-dioxoanthracen-1-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 6144251 |
| Molecular Formula | C38H34N2O8 |
| Molecular Weight | 646.70 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | butyl 4-[[4-[(4-butoxycarbonylbenzoyl)amino]-9,10-dioxoanthracen-1-yl]carbamoyl]benzoate |
| SMILES | CCCCOC(=O)c1ccc(C(=O)Nc2ccc(NC(=O)c3ccc(C(=O)OCCCC)cc3)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C38H34N2O8/c1-3-5-21-47-37(45)25-15-11-23(12-16-25)35(43)39-29-19-20-30(32-31(29)33(41)27-9-7-8-10-28(27)34(32)42)40-36(44)24-13-17-26(18-14-24)38(46)48-22-6-4-2/h7-20H,3-6,21-22H2,1-2H3,(H,39,43)(H,40,44) |
| InChIKey | PZXDZRDSSHLSDM-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.70 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|