C25H22N2O4 — CID 102093473
N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butoxybenzamide (PubChem CID 102093473) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butoxybenzamide.
| Compound Name | N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butoxybenzamide |
|---|---|
| PubChem CID | 102093473 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | N-(4-amino-9,10-dioxoanthracen-1-yl)-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N)c3c2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-2-3-14-31-16-10-8-15(9-11-16)25(30)27-20-13-12-19(26)21-22(20)24(29)18-7-5-4-6-17(18)23(21)28/h4-13H,2-3,14,26H2,1H3,(H,27,30) |
| InChIKey | HJHOQZCELPRVRL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|