C16H13N3O3 — CID 10402224
2-amino-N-(4-amino-9,10-dioxoanthracen-1-yl)acetamide (PubChem CID 10402224) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-amino-N-(4-amino-9,10-dioxoanthracen-1-yl)acetamide.
| Compound Name | 2-amino-N-(4-amino-9,10-dioxoanthracen-1-yl)acetamide |
|---|---|
| PubChem CID | 10402224 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-amino-N-(4-amino-9,10-dioxoanthracen-1-yl)acetamide |
| SMILES | NCC(=O)Nc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H13N3O3/c17-7-12(20)19-11-6-5-10(18)13-14(11)16(22)9-4-2-1-3-8(9)15(13)21/h1-6H,7,17-18H2,(H,19,20) |
| InChIKey | KPDPSCPHTZLGNR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|