C15H12N2O4S — CID 139789292
N-(4-amino-9,10-dioxoanthracen-1-yl)methanesulfonamide (PubChem CID 139789292) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is N-(4-amino-9,10-dioxoanthracen-1-yl)methanesulfonamide.
| Compound Name | N-(4-amino-9,10-dioxoanthracen-1-yl)methanesulfonamide |
|---|---|
| PubChem CID | 139789292 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(4-amino-9,10-dioxoanthracen-1-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C15H12N2O4S/c1-22(20,21)17-11-7-6-10(16)12-13(11)15(19)9-5-3-2-4-8(9)14(12)18/h2-7,17H,16H2,1H3 |
| InChIKey | JIIKNXYWHUMLOF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|