C31H23NO4 — CID 90789335
1-(4-amino-9,10-dioxoanthracen-1-yl)-4-methylanthracene-9,10-dione;ethane (PubChem CID 90789335) has the molecular formula C31H23NO4 and a molecular weight of 473.53 g/mol. Its IUPAC name is 1-(4-amino-9,10-dioxoanthracen-1-yl)-4-methylanthracene-9,10-dione;ethane.
| Compound Name | 1-(4-amino-9,10-dioxoanthracen-1-yl)-4-methylanthracene-9,10-dione;ethane |
|---|---|
| PubChem CID | 90789335 |
| Molecular Formula | C31H23NO4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-(4-amino-9,10-dioxoanthracen-1-yl)-4-methylanthracene-9,10-dione;ethane |
| SMILES | CC.Cc1ccc(-c2ccc(N)c3c2C(=O)c2ccccc2C3=O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H17NO4.C2H6/c1-14-10-11-15(23-22(14)26(31)17-6-2-3-7-18(17)27(23)32)16-12-13-21(30)25-24(16)28(33)19-8-4-5-9-20(19)29(25)34;1-2/h2-13H,30H2,1H3;1-2H3 |
| InChIKey | MPCWEOWUIWHSJM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|