C21H14N2O4 — CID 154123925
2-amino-6-(4-amino-9,10-dioxoanthracen-1-yl)benzoic acid (PubChem CID 154123925) has the molecular formula C21H14N2O4 and a molecular weight of 358.35 g/mol. Its IUPAC name is 2-amino-6-(4-amino-9,10-dioxoanthracen-1-yl)benzoic acid.
| Compound Name | 2-amino-6-(4-amino-9,10-dioxoanthracen-1-yl)benzoic acid |
|---|---|
| PubChem CID | 154123925 |
| Molecular Formula | C21H14N2O4 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-amino-6-(4-amino-9,10-dioxoanthracen-1-yl)benzoic acid |
| SMILES | Nc1cccc(-c2ccc(N)c3c2C(=O)c2ccccc2C3=O)c1C(=O)O |
| InChI | InChI=1S/C21H14N2O4/c22-14-7-3-6-10(16(14)21(26)27)11-8-9-15(23)18-17(11)19(24)12-4-1-2-5-13(12)20(18)25/h1-9H,22-23H2,(H,26,27) |
| InChIKey | OVABSYDUXVVAEN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|