C15H11Cl2NO2 — CID 160969534
1-aminoanthracene-9,10-dione;dichloromethane (PubChem CID 160969534) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is 1-aminoanthracene-9,10-dione;dichloromethane.
| Compound Name | 1-aminoanthracene-9,10-dione;dichloromethane |
|---|---|
| PubChem CID | 160969534 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 1-aminoanthracene-9,10-dione;dichloromethane |
| SMILES | ClCCl.Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO2.CH2Cl2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16;2-1-3/h1-7H,15H2;1H2 |
| InChIKey | SYBNSBALOVTERL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|