C15H11NO2S — CID 154170210
1-amino-7-methylsulfanylanthracene-9,10-dione (PubChem CID 154170210) has the molecular formula C15H11NO2S and a molecular weight of 269.33 g/mol. Its IUPAC name is 1-amino-7-methylsulfanylanthracene-9,10-dione.
| Compound Name | 1-amino-7-methylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 154170210 |
| Molecular Formula | C15H11NO2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1-amino-7-methylsulfanylanthracene-9,10-dione |
| SMILES | CSc1ccc2c(c1)C(=O)c1c(N)cccc1C2=O |
| InChI | InChI=1S/C15H11NO2S/c1-19-8-5-6-9-11(7-8)15(18)13-10(14(9)17)3-2-4-12(13)16/h2-7H,16H2,1H3 |
| InChIKey | PSANCCGHPMAMIV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|