C15H12OS2 — CID 175439265
2,7-bis(methylsulfanyl)fluoren-9-one (PubChem CID 175439265) has the molecular formula C15H12OS2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2,7-bis(methylsulfanyl)fluoren-9-one.
| Compound Name | 2,7-bis(methylsulfanyl)fluoren-9-one |
|---|---|
| PubChem CID | 175439265 |
| Molecular Formula | C15H12OS2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2,7-bis(methylsulfanyl)fluoren-9-one |
| SMILES | CSc1ccc2c(c1)C(=O)c1cc(SC)ccc1-2 |
| InChI | InChI=1S/C15H12OS2/c1-17-9-3-5-11-12-6-4-10(18-2)8-14(12)15(16)13(11)7-9/h3-8H,1-2H3 |
| InChIKey | IGTJCGAIWZSFEO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |