C12H10N4OS — CID 142105925
2-amino-3-methylidene-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one (PubChem CID 142105925) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-amino-3-methylidene-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one.
| Compound Name | 2-amino-3-methylidene-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one |
|---|---|
| PubChem CID | 142105925 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-amino-3-methylidene-8-methylsulfanylindeno[2,3-e][1,2,4]triazin-5-one |
| SMILES | C=C1N=C2C(=O)c3ccc(SC)cc3C2=NN1N |
| InChI | InChI=1S/C12H10N4OS/c1-6-14-11-10(15-16(6)13)9-5-7(18-2)3-4-8(9)12(11)17/h3-5H,1,13H2,2H3 |
| InChIKey | LJLCPUQMBUCZRT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|