C11H9N6OS+ — CID 59882645
3-diazenyl-2-imino-6-methylsulfanyl-3H-indeno[1,2-e][1,2,4]triazin-2-ium-9-one (PubChem CID 59882645) has the molecular formula C11H9N6OS+ and a molecular weight of 273.30 g/mol. Its IUPAC name is 3-diazenyl-2-imino-6-methylsulfanyl-3H-indeno[1,2-e][1,2,4]triazin-2-ium-9-one.
| Compound Name | 3-diazenyl-2-imino-6-methylsulfanyl-3H-indeno[1,2-e][1,2,4]triazin-2-ium-9-one |
|---|---|
| PubChem CID | 59882645 |
| Molecular Formula | C11H9N6OS+ |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-diazenyl-2-imino-6-methylsulfanyl-3H-indeno[1,2-e][1,2,4]triazin-2-ium-9-one |
| SMILES | [H]/N=[N+]1\N=C2C(=O)c3ccc(SC)cc3C2=NC1/N=N/[H] |
| InChI | InChI=1S/C11H9N6OS/c1-19-5-2-3-6-7(4-5)8-9(10(6)18)16-17(13)11(14-8)15-12/h2-4,11-13H,1H3/q+1/b15-12+,17-13- |
| InChIKey | AVTYZUUVSCUJQD-GXDIDPINSA-N |
| XLogP | 2.12 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|