About S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate
S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate (PubChem CID 101344095) has the molecular formula C18H12O4S2
and a molecular weight of 356.42 g/mol. Its IUPAC name is S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate.
Molecular Properties
| Compound Name | S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate |
| PubChem CID | 101344095 |
| Molecular Formula | C18H12O4S2 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate |
| SMILES | CC(=O)Sc1ccc2c(c1)C(=O)C(=O)c1cc(SC(C)=O)ccc1-2 |
| InChI | InChI=1S/C18H12O4S2/c1-9(19)23-11-3-5-13-14-6-4-12(24-10(2)20)8-16(14)18(22)17(21)15(13)7-11/h3-8H,1-2H3 |
| InChIKey | LJUHJUSTZJTDQM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate?
The IUPAC name of S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate (CID 101344095) is S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate.
What is the SMILES notation for S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate?
The canonical SMILES for S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate is CC(=O)Sc1ccc2c(c1)C(=O)C(=O)c1cc(SC(C)=O)ccc1-2.
What is the InChIKey of S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate?
The InChIKey is LJUHJUSTZJTDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O4S2/c1-9(19)23-11-3-5-13-14-6-4-12(24-10(2)20)8-16(14)18(22)17(21)15(13)7-11/h3-8H,1-2H3.
What are the key properties of S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate?
S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate has a molecular weight of 356.42 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(7-acetylsulfanyl-9,10-dioxophenanthren-2-yl) ethanethioate is sourced from PubChem (CID 101344095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).