About S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate
S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate (PubChem CID 177065176) has the molecular formula C25H14O3S
and a molecular weight of 394.45 g/mol. Its IUPAC name is S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate.
Molecular Properties
| Compound Name | S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate |
| PubChem CID | 177065176 |
| Molecular Formula | C25H14O3S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate |
| SMILES | O=C(Sc1ccc2ccccc2c1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H14O3S/c26-23-19-7-3-4-8-20(19)24(27)22-14-17(10-12-21(22)23)25(28)29-18-11-9-15-5-1-2-6-16(15)13-18/h1-14H |
| InChIKey | JMUHLVBRADONQH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate?
The IUPAC name of S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate (CID 177065176) is S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate.
What is the SMILES notation for S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate?
The canonical SMILES for S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate is O=C(Sc1ccc2ccccc2c1)c1ccc2c(c1)C(=O)c1ccccc1C2=O.
What is the InChIKey of S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate?
The InChIKey is JMUHLVBRADONQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H14O3S/c26-23-19-7-3-4-8-20(19)24(27)22-14-17(10-12-21(22)23)25(28)29-18-11-9-15-5-1-2-6-16(15)13-18/h1-14H.
What are the key properties of S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate?
S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate has a molecular weight of 394.45 g/mol, XLogP of 5.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-naphthalen-2-yl 9,10-dioxoanthracene-2-carbothioate is sourced from PubChem (CID 177065176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).