C25H15NO3 — CID 102214638
N-naphthalen-1-yl-9,10-dioxoanthracene-2-carboxamide (PubChem CID 102214638) has the molecular formula C25H15NO3 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-naphthalen-1-yl-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-naphthalen-1-yl-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 102214638 |
| Molecular Formula | C25H15NO3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-naphthalen-1-yl-9,10-dioxoanthracene-2-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C25H15NO3/c27-23-18-9-3-4-10-19(18)24(28)21-14-16(12-13-20(21)23)25(29)26-22-11-5-7-15-6-1-2-8-17(15)22/h1-14H,(H,26,29) |
| InChIKey | WPWJVQHTAQCYLJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|