C29H16N2O5 — CID 143844115
9,10-dioxo-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]anthracene-2-carboxamide (PubChem CID 143844115) has the molecular formula C29H16N2O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is 9,10-dioxo-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]anthracene-2-carboxamide.
| Compound Name | 9,10-dioxo-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]anthracene-2-carboxamide |
|---|---|
| PubChem CID | 143844115 |
| Molecular Formula | C29H16N2O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 9,10-dioxo-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]anthracene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2c(=O)o1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H16N2O5/c32-25-17-7-1-2-8-18(17)26(33)22-15-16(13-14-19(22)25)27(34)30-23-11-5-3-9-20(23)28-31-24-12-6-4-10-21(24)29(35)36-28/h1-15H,(H,30,34) |
| InChIKey | WPDWEJBKMFPMNF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|