C16H9F3N2O3 — CID 825300
2,2,2-trifluoro-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]acetamide (PubChem CID 825300) has the molecular formula C16H9F3N2O3 and a molecular weight of 334.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 825300 |
| Molecular Formula | C16H9F3N2O3 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2c(=O)o1)C(F)(F)F |
| InChI | InChI=1S/C16H9F3N2O3/c17-16(18,19)15(23)21-11-7-3-1-5-9(11)13-20-12-8-4-2-6-10(12)14(22)24-13/h1-8H,(H,21,23) |
| InChIKey | OESYATCJAHPFLT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |