C25H16N2O5S — CID 135365496
1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide (PubChem CID 135365496) has the molecular formula C25H16N2O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide.
| Compound Name | 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 135365496 |
| Molecular Formula | C25H16N2O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=Cc1c(S(=O)(=O)Nc2ccccc2-c2nc3ccccc3c(=O)o2)ccc2ccccc12 |
| InChI | InChI=1S/C25H16N2O5S/c28-15-20-17-8-2-1-7-16(17)13-14-23(20)33(30,31)27-22-12-6-3-9-18(22)24-26-21-11-5-4-10-19(21)25(29)32-24/h1-15,27H |
| InChIKey | KWOFHPOIAHZAKI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|