About 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide
1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide (PubChem CID 135365496) has the molecular formula C25H16N2O5S
and a molecular weight of 456.48 g/mol. Its IUPAC name is 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide.
Molecular Properties
| Compound Name | 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide |
| PubChem CID | 135365496 |
| Molecular Formula | C25H16N2O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=Cc1c(S(=O)(=O)Nc2ccccc2-c2nc3ccccc3c(=O)o2)ccc2ccccc12 |
| InChI | InChI=1S/C25H16N2O5S/c28-15-20-17-8-2-1-7-16(17)13-14-23(20)33(30,31)27-22-12-6-3-9-18(22)24-26-21-11-5-4-10-19(21)25(29)32-24/h1-15,27H |
| InChIKey | KWOFHPOIAHZAKI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide?
The IUPAC name of 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide (CID 135365496) is 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide.
What is the SMILES notation for 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide?
The canonical SMILES for 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide is O=Cc1c(S(=O)(=O)Nc2ccccc2-c2nc3ccccc3c(=O)o2)ccc2ccccc12.
What is the InChIKey of 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide?
The InChIKey is KWOFHPOIAHZAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H16N2O5S/c28-15-20-17-8-2-1-7-16(17)13-14-23(20)33(30,31)27-22-12-6-3-9-18(22)24-26-21-11-5-4-10-19(21)25(29)32-24/h1-15,27H.
What are the key properties of 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide?
1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide has a molecular weight of 456.48 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-formyl-N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]naphthalene-2-sulfonamide is sourced from PubChem (CID 135365496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).