C27H18N2O5 — CID 143844163
[3-[[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]naphthalen-2-yl] acetate (PubChem CID 143844163) has the molecular formula C27H18N2O5 and a molecular weight of 450.45 g/mol. Its IUPAC name is [3-[[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]naphthalen-2-yl] acetate.
| Compound Name | [3-[[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 143844163 |
| Molecular Formula | C27H18N2O5 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [3-[[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]carbamoyl]naphthalen-2-yl] acetate |
| SMILES | CC(=O)Oc1cc2ccccc2cc1C(=O)Nc1ccccc1-c1nc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C27H18N2O5/c1-16(30)33-24-15-18-9-3-2-8-17(18)14-21(24)25(31)28-22-12-6-4-10-19(22)26-29-23-13-7-5-11-20(23)27(32)34-26/h2-15H,1H3,(H,28,31) |
| InChIKey | BHKZASAPVUHBLB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|