C26H18N2O4 — CID 4158404
[4-[(2-benzo[g][1,3]benzoxazol-2-ylphenyl)carbamoyl]phenyl] acetate (PubChem CID 4158404) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is [4-[(2-benzo[g][1,3]benzoxazol-2-ylphenyl)carbamoyl]phenyl] acetate.
| Compound Name | [4-[(2-benzo[g][1,3]benzoxazol-2-ylphenyl)carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 4158404 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [4-[(2-benzo[g][1,3]benzoxazol-2-ylphenyl)carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)Nc2ccccc2-c2nc3ccc4ccccc4c3o2)cc1 |
| InChI | InChI=1S/C26H18N2O4/c1-16(29)31-19-13-10-18(11-14-19)25(30)27-22-9-5-4-8-21(22)26-28-23-15-12-17-6-2-3-7-20(17)24(23)32-26/h2-15H,1H3,(H,27,30) |
| InChIKey | YOBUMUGVFHXAOZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|