C24H15IN2O2 — CID 4188409
N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-iodobenzamide (PubChem CID 4188409) has the molecular formula C24H15IN2O2 and a molecular weight of 490.30 g/mol. Its IUPAC name is N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-iodobenzamide.
| Compound Name | N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 4188409 |
| Molecular Formula | C24H15IN2O2 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-4-iodobenzamide |
| SMILES | O=C(Nc1ccccc1-c1nc2c(ccc3ccccc32)o1)c1ccc(I)cc1 |
| InChI | InChI=1S/C24H15IN2O2/c25-17-12-9-16(10-13-17)23(28)26-20-8-4-3-7-19(20)24-27-22-18-6-2-1-5-15(18)11-14-21(22)29-24/h1-14H,(H,26,28) |
| InChIKey | UZZTURVNXNDLRI-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|