C26H16Cl2N2O2 — CID 3258462
N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 3258462) has the molecular formula C26H16Cl2N2O2 and a molecular weight of 459.33 g/mol. Its IUPAC name is N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3258462 |
| Molecular Formula | C26H16Cl2N2O2 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-(2-benzo[e][1,3]benzoxazol-2-ylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1ccccc1-c1nc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C26H16Cl2N2O2/c27-18-12-9-17(21(28)15-18)11-14-24(31)29-22-8-4-3-7-20(22)26-30-25-19-6-2-1-5-16(19)10-13-23(25)32-26/h1-15H,(H,29,31) |
| InChIKey | DVJWFOVGXUZIIE-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|