C17H12ClNO3 — CID 139188963
methyl (E)-3-[2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]prop-2-enoate (PubChem CID 139188963) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is methyl (E)-3-[2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139188963 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | methyl (E)-3-[2-(5-chloro-1,3-benzoxazol-2-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1-c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H12ClNO3/c1-21-16(20)9-6-11-4-2-3-5-13(11)17-19-14-10-12(18)7-8-15(14)22-17/h2-10H,1H3/b9-6+ |
| InChIKey | OHIHJIBGFMTBOH-RMKNXTFCSA-N |
| XLogP | 4.33 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|