C21H14ClFN2O2 — CID 1497023
N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-fluorobenzamide (PubChem CID 1497023) has the molecular formula C21H14ClFN2O2 and a molecular weight of 380.81 g/mol. Its IUPAC name is N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-fluorobenzamide.
| Compound Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 1497023 |
| Molecular Formula | C21H14ClFN2O2 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]-3-fluorobenzamide |
| SMILES | Cc1c(NC(=O)c2cccc(F)c2)cccc1-c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C21H14ClFN2O2/c1-12-16(21-25-18-11-14(22)8-9-19(18)27-21)6-3-7-17(12)24-20(26)13-4-2-5-15(23)10-13/h2-11H,1H3,(H,24,26) |
| InChIKey | RVBGNOINRMOYJU-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |