C26H24ClN3O2S — CID 2298980
4-tert-butyl-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide (PubChem CID 2298980) has the molecular formula C26H24ClN3O2S and a molecular weight of 478.02 g/mol. Its IUPAC name is 4-tert-butyl-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2298980 |
| Molecular Formula | C26H24ClN3O2S |
| Molecular Weight | 478.02 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 4-tert-butyl-N-[[3-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]benzamide |
| SMILES | Cc1c(NC(=S)NC(=O)c2ccc(C(C)(C)C)cc2)cccc1-c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C26H24ClN3O2S/c1-15-19(24-28-21-14-18(27)12-13-22(21)32-24)6-5-7-20(15)29-25(33)30-23(31)16-8-10-17(11-9-16)26(2,3)4/h5-14H,1-4H3,(H2,29,30,31,33) |
| InChIKey | FCEWCTZOVJREAZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.02 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|