C23H16ClNO4 — CID 142715971
methyl (E)-3-[4-[6-(4-chlorophenoxy)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoate (PubChem CID 142715971) has the molecular formula C23H16ClNO4 and a molecular weight of 405.84 g/mol. Its IUPAC name is methyl (E)-3-[4-[6-(4-chlorophenoxy)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[6-(4-chlorophenoxy)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 142715971 |
| Molecular Formula | C23H16ClNO4 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl (E)-3-[4-[6-(4-chlorophenoxy)-1,3-benzoxazol-2-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(-c2nc3ccc(Oc4ccc(Cl)cc4)cc3o2)cc1 |
| InChI | InChI=1S/C23H16ClNO4/c1-27-22(26)13-4-15-2-5-16(6-3-15)23-25-20-12-11-19(14-21(20)29-23)28-18-9-7-17(24)8-10-18/h2-14H,1H3/b13-4+ |
| InChIKey | FGTBOKZZANUQBA-YIXHJXPBSA-N |
| XLogP | 6.13 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|